About 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one
11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one (PubChem CID 73083052) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one.
Molecular Properties
| Compound Name | 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one |
| PubChem CID | 73083052 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one |
| SMILES | O=C1CC2C=C3CCCCC1C3O2 |
| InChI | InChI=1S/C11H14O2/c12-10-6-8-5-7-3-1-2-4-9(10)11(7)13-8/h5,8-9,11H,1-4,6H2 |
| InChIKey | KILBYYBMSDBAMH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one?
The IUPAC name of 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one (CID 73083052) is 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one.
What is the SMILES notation for 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one?
The canonical SMILES for 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one is O=C1CC2C=C3CCCCC1C3O2.
What is the InChIKey of 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one?
The InChIKey is KILBYYBMSDBAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-10-6-8-5-7-3-1-2-4-9(10)11(7)13-8/h5,8-9,11H,1-4,6H2.
What are the key properties of 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one?
11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one has a molecular weight of 178.23 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-oxatricyclo[7.2.1.04,10]dodec-9(12)-en-3-one is sourced from PubChem (CID 73083052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).