About 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone
1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone (PubChem CID 73083158) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone.
Molecular Properties
| Compound Name | 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone |
| PubChem CID | 73083158 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone |
| SMILES | CC(=O)C1(O)CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C12H20O2/c1-8(13)12(14)7-9-5-6-11(12,4)10(9,2)3/h9,14H,5-7H2,1-4H3 |
| InChIKey | LJPHLAJBHFCHOY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone?
The IUPAC name of 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone (CID 73083158) is 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone.
What is the SMILES notation for 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone?
The canonical SMILES for 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone is CC(=O)C1(O)CC2CCC1(C)C2(C)C.
What is the InChIKey of 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone?
The InChIKey is LJPHLAJBHFCHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-8(13)12(14)7-9-5-6-11(12,4)10(9,2)3/h9,14H,5-7H2,1-4H3.
What are the key properties of 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone?
1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone has a molecular weight of 196.29 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethanone is sourced from PubChem (CID 73083158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).