C18H20F2N2O5 — CID 73084632
butyl 3-(1-ethyl-3,3-difluoro-2-oxoindol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxylate (PubChem CID 73084632) has the molecular formula C18H20F2N2O5 and a molecular weight of 382.36 g/mol. Its IUPAC name is butyl 3-(1-ethyl-3,3-difluoro-2-oxoindol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxylate.
| Compound Name | butyl 3-(1-ethyl-3,3-difluoro-2-oxoindol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 73084632 |
| Molecular Formula | C18H20F2N2O5 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | butyl 3-(1-ethyl-3,3-difluoro-2-oxoindol-5-yl)-2-oxo-1,3-oxazolidine-5-carboxylate |
| SMILES | CCCCOC(=O)C1CN(c2ccc3c(c2)C(F)(F)C(=O)N3CC)C(=O)O1 |
| InChI | InChI=1S/C18H20F2N2O5/c1-3-5-8-26-15(23)14-10-22(17(25)27-14)11-6-7-13-12(9-11)18(19,20)16(24)21(13)4-2/h6-7,9,14H,3-5,8,10H2,1-2H3 |
| InChIKey | HNFIOOHFXPNAQX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|