C27H30F3N3O4 — CID 73085859
1-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydropyrano[2,3-b]pyridin-7-yl]methyl]azetidine-3-carboxylic acid (PubChem CID 73085859) has the molecular formula C27H30F3N3O4 and a molecular weight of 517.55 g/mol. Its IUPAC name is 1-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydropyrano[2,3-b]pyridin-7-yl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydropyrano[2,3-b]pyridin-7-yl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 73085859 |
| Molecular Formula | C27H30F3N3O4 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 1-[[4-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydropyrano[2,3-b]pyridin-7-yl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc3c(n2)OCCC3=NOCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C27H30F3N3O4/c28-27(29,30)23-12-17(6-8-21(23)18-4-2-1-3-5-18)16-37-32-24-10-11-36-25-22(24)9-7-20(31-25)15-33-13-19(14-33)26(34)35/h6-9,12,18-19H,1-5,10-11,13-16H2,(H,34,35) |
| InChIKey | ZYMIRLYHFCDNDG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|