C20H30N2O4 — CID 73089169
tert-butyl N-[4-[5-oxo-2-(1-phenylethyl)-1,2-oxazolidin-4-yl]butyl]carbamate (PubChem CID 73089169) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl N-[4-[5-oxo-2-(1-phenylethyl)-1,2-oxazolidin-4-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-oxo-2-(1-phenylethyl)-1,2-oxazolidin-4-yl]butyl]carbamate |
|---|---|
| PubChem CID | 73089169 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl N-[4-[5-oxo-2-(1-phenylethyl)-1,2-oxazolidin-4-yl]butyl]carbamate |
| SMILES | CC(c1ccccc1)N1CC(CCCCNC(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C20H30N2O4/c1-15(16-10-6-5-7-11-16)22-14-17(18(23)26-22)12-8-9-13-21-19(24)25-20(2,3)4/h5-7,10-11,15,17H,8-9,12-14H2,1-4H3,(H,21,24) |
| InChIKey | CIQDMMUYRLMXJT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|