C32H29NO5 — CID 73090543
2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 73090543) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 73090543 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H29NO5/c1-33(32(36)38-21-29-27-13-7-5-11-25(27)26-12-6-8-14-28(26)29)30(31(34)35)19-22-15-17-24(18-16-22)37-20-23-9-3-2-4-10-23/h2-18,29-30H,19-21H2,1H3,(H,34,35) |
| InChIKey | PWRIYHZWFNFNDD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |