C19H21NO8 — CID 7309333
tetramethyl (9aS)-7,9-dimethyl-9aH-quinolizine-1,2,3,4-tetracarboxylate (PubChem CID 7309333) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is tetramethyl (9aS)-7,9-dimethyl-9aH-quinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl (9aS)-7,9-dimethyl-9aH-quinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 7309333 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tetramethyl (9aS)-7,9-dimethyl-9aH-quinolizine-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C(C)=CC(C)=CN2C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C19H21NO8/c1-9-7-10(2)14-12(17(22)26-4)11(16(21)25-3)13(18(23)27-5)15(19(24)28-6)20(14)8-9/h7-8,14H,1-6H3/t14-/m0/s1 |
| InChIKey | NIAYDOWGZDIMJA-AWEZNQCLSA-N |
| XLogP | 0.78 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|