About 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one
9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one (PubChem CID 73094437) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one.
Molecular Properties
| Compound Name | 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one |
| PubChem CID | 73094437 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one |
| SMILES | O=C1OC2C=CC1C1CCCCC21 |
| InChI | InChI=1S/C11H14O2/c12-11-9-5-6-10(13-11)8-4-2-1-3-7(8)9/h5-10H,1-4H2 |
| InChIKey | YQYHFJFEUDZLRS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one?
The IUPAC name of 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one (CID 73094437) is 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one.
What is the SMILES notation for 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one?
The canonical SMILES for 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one is O=C1OC2C=CC1C1CCCCC21.
What is the InChIKey of 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one?
The InChIKey is YQYHFJFEUDZLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-11-9-5-6-10(13-11)8-4-2-1-3-7(8)9/h5-10H,1-4H2.
What are the key properties of 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one?
9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one has a molecular weight of 178.23 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one is sourced from PubChem (CID 73094437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).