C24H35NO2 — CID 7309794
(2R)-N-[2-(1-adamantyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 7309794) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (2R)-N-[2-(1-adamantyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | (2R)-N-[2-(1-adamantyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 7309794 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (2R)-N-[2-(1-adamantyl)ethyl]-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc(C)c(C)c1)C(=O)NCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H35NO2/c1-4-22(27-21-6-5-16(2)17(3)9-21)23(26)25-8-7-24-13-18-10-19(14-24)12-20(11-18)15-24/h5-6,9,18-20,22H,4,7-8,10-15H2,1-3H3,(H,25,26)/t18?,19?,20?,22-,24?/m1/s1 |
| InChIKey | NWQARWPTYZKZFX-GPUVRGFBSA-N |
| XLogP | 5.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |