C17H21NO4 — CID 73098641
methyl 3-benzyl-6-hydroxy-9-oxo-3-azabicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 73098641) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 3-benzyl-6-hydroxy-9-oxo-3-azabicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | methyl 3-benzyl-6-hydroxy-9-oxo-3-azabicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 73098641 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 3-benzyl-6-hydroxy-9-oxo-3-azabicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | COC(=O)C12CCC(O)C(CN(Cc3ccccc3)C1)C2=O |
| InChI | InChI=1S/C17H21NO4/c1-22-16(21)17-8-7-14(19)13(15(17)20)10-18(11-17)9-12-5-3-2-4-6-12/h2-6,13-14,19H,7-11H2,1H3 |
| InChIKey | AELLDRRHPHOMMJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|