C22H25N2O3S- — CID 7310036
(1S,6R)-6-[[4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7310036) has the molecular formula C22H25N2O3S- and a molecular weight of 397.52 g/mol. Its IUPAC name is (1S,6R)-6-[[4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[[4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7310036 |
| Molecular Formula | C22H25N2O3S- |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (1S,6R)-6-[[4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)C[C@@H](C(=O)Nc2nc(-c3ccc(C)cc3C)c(C)s2)[C@@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C22H26N2O3S/c1-11-6-7-16(14(4)8-11)19-15(5)28-22(23-19)24-20(25)17-9-12(2)13(3)10-18(17)21(26)27/h6-8,17-18H,9-10H2,1-5H3,(H,26,27)(H,23,24,25)/p-1/t17-,18+/m1/s1 |
| InChIKey | IAJMHXAPLGFHOT-MSOLQXFVSA-M |
| XLogP | 3.79 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|