C26H38N2O2 — CID 7310067
(3R,5R,8R,9S,10S,13S,14S,16Z)-3-hydroxy-10,13-dimethyl-16-[(1,3,5-trimethylpyrazol-4-yl)methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 7310067) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S,16Z)-3-hydroxy-10,13-dimethyl-16-[(1,3,5-trimethylpyrazol-4-yl)methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S,16Z)-3-hydroxy-10,13-dimethyl-16-[(1,3,5-trimethylpyrazol-4-yl)methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 7310067 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S,16Z)-3-hydroxy-10,13-dimethyl-16-[(1,3,5-trimethylpyrazol-4-yl)methylidene]-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | Cc1nn(C)c(C)c1/C=C1/C[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C26H38N2O2/c1-15-21(16(2)28(5)27-15)12-17-13-23-20-7-6-18-14-19(29)8-10-25(18,3)22(20)9-11-26(23,4)24(17)30/h12,18-20,22-23,29H,6-11,13-14H2,1-5H3/b17-12-/t18-,19-,20-,22+,23+,25+,26+/m1/s1 |
| InChIKey | QAZWWNKLOZAMBB-IOUFMVEBSA-N |
| XLogP | 5.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|