C12H16Cl4N2O2 — CID 7310189
(1R)-2,2-dichloro-N-[2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]ethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 7310189) has the molecular formula C12H16Cl4N2O2 and a molecular weight of 362.08 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]ethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]ethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7310189 |
| Molecular Formula | C12H16Cl4N2O2 |
| Molecular Weight | 362.08 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | (1R)-2,2-dichloro-N-[2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]ethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NCCNC(=O)[C@@]2(C)CC2(Cl)Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C12H16Cl4N2O2/c1-9(5-11(9,13)14)7(19)17-3-4-18-8(20)10(2)6-12(10,15)16/h3-6H2,1-2H3,(H,17,19)(H,18,20)/t9-,10-/m1/s1 |
| InChIKey | GEKLHURDRQUBRS-NXEZZACHSA-N |
| XLogP | 2.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.08 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|