C15H18NO3+ — CID 7310281
(2R,3R,6S)-3-ethyl-2,6-bis(furan-2-yl)piperidin-1-ium-4-one (PubChem CID 7310281) has the molecular formula C15H18NO3+ and a molecular weight of 260.31 g/mol. Its IUPAC name is (2R,3R,6S)-3-ethyl-2,6-bis(furan-2-yl)piperidin-1-ium-4-one.
| Compound Name | (2R,3R,6S)-3-ethyl-2,6-bis(furan-2-yl)piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7310281 |
| Molecular Formula | C15H18NO3+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2R,3R,6S)-3-ethyl-2,6-bis(furan-2-yl)piperidin-1-ium-4-one |
| SMILES | CC[C@H]1C(=O)C[C@@H](c2ccco2)[NH2+][C@H]1c1ccco1 |
| InChI | InChI=1S/C15H17NO3/c1-2-10-12(17)9-11(13-5-3-7-18-13)16-15(10)14-6-4-8-19-14/h3-8,10-11,15-16H,2,9H2,1H3/p+1/t10-,11-,15+/m0/s1 |
| InChIKey | RGNPXEMHSDVXIB-ZIBATOQPSA-O |
| XLogP | 2.22 |
| TPSA | 59.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |