C23H30N2O5 — CID 73104997
methyl 14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate (PubChem CID 73104997) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl 14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate.
| Compound Name | methyl 14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate |
|---|---|
| PubChem CID | 73104997 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl 14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate |
| SMILES | COC(=O)C1C(C)OCC2C1CC1N(C)CCC13c1cccc(O)c1N(C(C)=O)C23 |
| InChI | InChI=1S/C23H30N2O5/c1-12-19(22(28)29-4)14-10-18-23(8-9-24(18)3)16-6-5-7-17(27)20(16)25(13(2)26)21(23)15(14)11-30-12/h5-7,12,14-15,18-19,21,27H,8-11H2,1-4H3 |
| InChIKey | ZQPCCJJZXCRROO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |