C31H50O2 — CID 73105953
17-(5-tert-butyl-6-methylhepta-3,6-dien-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 73105953) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is 17-(5-tert-butyl-6-methylhepta-3,6-dien-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | 17-(5-tert-butyl-6-methylhepta-3,6-dien-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 73105953 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 17-(5-tert-butyl-6-methylhepta-3,6-dien-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C=C(C)C(C=CC(C)C1CCC2C3C(O)C=C4CC(O)CCC4(C)C3CCC12C)C(C)(C)C |
| InChI | InChI=1S/C31H50O2/c1-19(2)23(29(4,5)6)10-9-20(3)24-11-12-25-28-26(14-16-31(24,25)8)30(7)15-13-22(32)17-21(30)18-27(28)33/h9-10,18,20,22-28,32-33H,1,11-17H2,2-8H3 |
| InChIKey | FGXRQUHWLBWKIC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|