About N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide
N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide (PubChem CID 7310618) has the molecular formula C23H31NO4S
and a molecular weight of 417.57 g/mol. Its IUPAC name is N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide |
| PubChem CID | 7310618 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide |
| SMILES | COC(C)(C)CCC[C@H](C)CCNS(=O)(=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C23H31NO4S/c1-17(8-7-14-23(2,3)27-4)13-15-24-29(25,26)18-11-12-22-20(16-18)19-9-5-6-10-21(19)28-22/h5-6,9-12,16-17,24H,7-8,13-15H2,1-4H3/t17-/m0/s1 |
| InChIKey | YQVUAFZGOWHMOP-KRWDZBQOSA-N |
| XLogP | 5.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide?
The IUPAC name of N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide (CID 7310618) is N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide.
What is the SMILES notation for N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide?
The canonical SMILES for N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide is COC(C)(C)CCC[C@H](C)CCNS(=O)(=O)c1ccc2oc3ccccc3c2c1.
What is the InChIKey of N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide?
The InChIKey is YQVUAFZGOWHMOP-KRWDZBQOSA-N. The full InChI is InChI=1S/C23H31NO4S/c1-17(8-7-14-23(2,3)27-4)13-15-24-29(25,26)18-11-12-22-20(16-18)19-9-5-6-10-21(19)28-22/h5-6,9-12,16-17,24H,7-8,13-15H2,1-4H3/t17-/m0/s1.
What are the key properties of N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide?
N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide has a molecular weight of 417.57 g/mol, XLogP of 5.49, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-7-methoxy-3,7-dimethyloctyl]dibenzofuran-2-sulfonamide is sourced from PubChem (CID 7310618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).