C15H13F15O — CID 73106667
2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)bicyclo[2.2.1]heptane (PubChem CID 73106667) has the molecular formula C15H13F15O and a molecular weight of 494.24 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)bicyclo[2.2.1]heptane.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 73106667 |
| Molecular Formula | C15H13F15O |
| Molecular Weight | 494.24 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)bicyclo[2.2.1]heptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC1CC2CCC1C2 |
| InChI | InChI=1S/C15H13F15O/c16-9(17,5-31-8-4-6-1-2-7(8)3-6)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h6-8H,1-5H2 |
| InChIKey | FVQCXNBBSMOJIL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.24 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|