C19H14BrNO4 — CID 7310760
(4aS,10bS)-3-benzyl-9-bromo-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione (PubChem CID 7310760) has the molecular formula C19H14BrNO4 and a molecular weight of 400.23 g/mol. Its IUPAC name is (4aS,10bS)-3-benzyl-9-bromo-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione.
| Compound Name | (4aS,10bS)-3-benzyl-9-bromo-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione |
|---|---|
| PubChem CID | 7310760 |
| Molecular Formula | C19H14BrNO4 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (4aS,10bS)-3-benzyl-9-bromo-4a,10b-dihydro-1H-chromeno[3,4-c]pyridine-2,4,5-trione |
| SMILES | O=C1Oc2ccc(Br)cc2[C@H]2CC(=O)N(Cc3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H14BrNO4/c20-12-6-7-15-13(8-12)14-9-16(22)21(10-11-4-2-1-3-5-11)18(23)17(14)19(24)25-15/h1-8,14,17H,9-10H2/t14-,17+/m1/s1 |
| InChIKey | PIOOFNUGFUFAHD-PBHICJAKSA-N |
| XLogP | 3.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|