C34H56O8 — CID 73108003
2-[3-propan-2-yl-6-(3,6,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-2-enoxy]oxane-3,4,5-triol (PubChem CID 73108003) has the molecular formula C34H56O8 and a molecular weight of 592.81 g/mol. Its IUPAC name is 2-[3-propan-2-yl-6-(3,6,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-2-enoxy]oxane-3,4,5-triol.
| Compound Name | 2-[3-propan-2-yl-6-(3,6,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-2-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 73108003 |
| Molecular Formula | C34H56O8 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | 2-[3-propan-2-yl-6-(3,6,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-2-enoxy]oxane-3,4,5-triol |
| SMILES | CC(C)C(=CCOC1OCC(O)C(O)C1O)CCC(C)C1CC(O)C2=C3CC(O)C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C34H56O8/c1-18(2)20(10-13-41-32-31(40)30(39)28(38)17-42-32)7-6-19(3)24-16-27(37)29-22-15-26(36)25-14-21(35)8-11-33(25,4)23(22)9-12-34(24,29)5/h10,18-19,21,23-28,30-32,35-40H,6-9,11-17H2,1-5H3 |
| InChIKey | AJGNSLVGGULVMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|