About pyrrolidine-2,3,4-triol
pyrrolidine-2,3,4-triol (PubChem CID 73110172) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is pyrrolidine-2,3,4-triol.
Molecular Properties
| Compound Name | pyrrolidine-2,3,4-triol |
| PubChem CID | 73110172 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | pyrrolidine-2,3,4-triol |
| SMILES | OC1CNC(O)C1O |
| InChI | InChI=1S/C4H9NO3/c6-2-1-5-4(8)3(2)7/h2-8H,1H2 |
| InChIKey | FNRDSSFSPPAIRA-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidine-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2,3,4-triol?
The IUPAC name of pyrrolidine-2,3,4-triol (CID 73110172) is pyrrolidine-2,3,4-triol.
What is the SMILES notation for pyrrolidine-2,3,4-triol?
The canonical SMILES for pyrrolidine-2,3,4-triol is OC1CNC(O)C1O.
What is the InChIKey of pyrrolidine-2,3,4-triol?
The InChIKey is FNRDSSFSPPAIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c6-2-1-5-4(8)3(2)7/h2-8H,1H2.
What are the key properties of pyrrolidine-2,3,4-triol?
pyrrolidine-2,3,4-triol has a molecular weight of 119.12 g/mol, XLogP of -2.37, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2,3,4-triol is sourced from PubChem (CID 73110172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).