About [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate
[3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate (PubChem CID 7311060) has the molecular formula C26H30O3
and a molecular weight of 390.52 g/mol. Its IUPAC name is [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate.
Molecular Properties
| Compound Name | [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate |
| PubChem CID | 7311060 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate |
| SMILES | CCCC[C@H](CC)C(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H30O3/c1-6-8-11-19(7-2)26(28)29-25-21-13-10-9-12-20(21)24(27)23(25)22-17(4)14-16(3)15-18(22)5/h9-10,12-15,19H,6-8,11H2,1-5H3/t19-/m0/s1 |
| InChIKey | VPZWBKSYSNFFTK-IBGZPJMESA-N |
| XLogP | 6.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate?
The IUPAC name of [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate (CID 7311060) is [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate.
What is the SMILES notation for [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate?
The canonical SMILES for [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate is CCCC[C@H](CC)C(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)c2ccccc21.
What is the InChIKey of [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate?
The InChIKey is VPZWBKSYSNFFTK-IBGZPJMESA-N. The full InChI is InChI=1S/C26H30O3/c1-6-8-11-19(7-2)26(28)29-25-21-13-10-9-12-20(21)24(27)23(25)22-17(4)14-16(3)15-18(22)5/h9-10,12-15,19H,6-8,11H2,1-5H3/t19-/m0/s1.
What are the key properties of [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate?
[3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate has a molecular weight of 390.52 g/mol, XLogP of 6.44, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-2-(2,4,6-trimethylphenyl)inden-1-yl] (2S)-2-ethylhexanoate is sourced from PubChem (CID 7311060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).