C14H21N5O2 — CID 73111332
11-[2-(diethylamino)ethyl]-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione (PubChem CID 73111332) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 11-[2-(diethylamino)ethyl]-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione.
| Compound Name | 11-[2-(diethylamino)ethyl]-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
|---|---|
| PubChem CID | 73111332 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 11-[2-(diethylamino)ethyl]-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
| SMILES | CCN(CC)CCN1C(=O)C2Cc3nc[nH]c3CN2C1=O |
| InChI | InChI=1S/C14H21N5O2/c1-3-17(4-2)5-6-18-13(20)12-7-10-11(16-9-15-10)8-19(12)14(18)21/h9,12H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | GWNFSVNJXVAUPK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|