C17H26N2O3 — CID 7311214
(2R)-2-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pentanamide (PubChem CID 7311214) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2R)-2-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pentanamide.
| Compound Name | (2R)-2-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pentanamide |
|---|---|
| PubChem CID | 7311214 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2R)-2-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pentanamide |
| SMILES | CCC[C@H](C(=O)Nc1ccc2c(c1)OCCO2)N(CC)CC |
| InChI | InChI=1S/C17H26N2O3/c1-4-7-14(19(5-2)6-3)17(20)18-13-8-9-15-16(12-13)22-11-10-21-15/h8-9,12,14H,4-7,10-11H2,1-3H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | QPTQTYNFZDLPTF-CQSZACIVSA-N |
| XLogP | 2.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |