C14H17BrO6 — CID 7311268
[(2S,3S,4R,5R,6S)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate (PubChem CID 7311268) has the molecular formula C14H17BrO6 and a molecular weight of 361.19 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R,6S)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 7311268 |
| Molecular Formula | C14H17BrO6 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](CBr)[C@@H](OC(=O)c2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17BrO6/c1-19-14-11(17)10(16)12(9(7-15)20-14)21-13(18)8-5-3-2-4-6-8/h2-6,9-12,14,16-17H,7H2,1H3/t9-,10-,11-,12-,14+/m1/s1 |
| InChIKey | VUWYKCUKVSNBJE-SKENRDBWSA-N |
| XLogP | 0.70 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|