C29H24O8 — CID 73113525
3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol (PubChem CID 73113525) has the molecular formula C29H24O8 and a molecular weight of 500.50 g/mol. Its IUPAC name is 3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol.
| Compound Name | 3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol |
|---|---|
| PubChem CID | 73113525 |
| Molecular Formula | C29H24O8 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 3-(3,5-dihydroxyphenyl)-2,7-bis(4-hydroxyphenyl)-3,7,8,9-tetrahydro-2H-furo[2,3-f]chromene-4,8-diol |
| SMILES | Oc1ccc(C2Oc3cc(O)c4c(c3CC2O)OC(c2ccc(O)cc2)C4c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C29H24O8/c30-17-5-1-14(2-6-17)27-23(35)12-21-24(36-27)13-22(34)26-25(16-9-19(32)11-20(33)10-16)28(37-29(21)26)15-3-7-18(31)8-4-15/h1-11,13,23,25,27-28,30-35H,12H2 |
| InChIKey | LYHUHVLRBIYLBQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |