C29H36O4SSi — CID 73113607
2-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl)ethanol (PubChem CID 73113607) has the molecular formula C29H36O4SSi and a molecular weight of 508.76 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl)ethanol.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl)ethanol |
|---|---|
| PubChem CID | 73113607 |
| Molecular Formula | C29H36O4SSi |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl)ethanol |
| SMILES | CC1(C)OC(Sc2ccccc2)C(C(O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H36O4SSi/c1-28(2,3)35(23-17-11-7-12-18-23,24-19-13-8-14-20-24)31-21-25(30)26-27(33-29(4,5)32-26)34-22-15-9-6-10-16-22/h6-20,25-27,30H,21H2,1-5H3 |
| InChIKey | JJVGRVUZTHEHLE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|