About 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide
8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide (PubChem CID 73115355) has the molecular formula C11H18FNO
and a molecular weight of 199.27 g/mol. Its IUPAC name is 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide.
Molecular Properties
| Compound Name | 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide |
| PubChem CID | 73115355 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CC12CCCC(C1F)C(C)(C(N)=O)C2 |
| InChI | InChI=1S/C11H18FNO/c1-10-5-3-4-7(8(10)12)11(2,6-10)9(13)14/h7-8H,3-6H2,1-2H3,(H2,13,14) |
| InChIKey | ANIMCUAYEVKTFT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide?
The IUPAC name of 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide (CID 73115355) is 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide.
What is the SMILES notation for 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide?
The canonical SMILES for 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide is CC12CCCC(C1F)C(C)(C(N)=O)C2.
What is the InChIKey of 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide?
The InChIKey is ANIMCUAYEVKTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FNO/c1-10-5-3-4-7(8(10)12)11(2,6-10)9(13)14/h7-8H,3-6H2,1-2H3,(H2,13,14).
What are the key properties of 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide?
8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide has a molecular weight of 199.27 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1,6-dimethylbicyclo[3.2.1]octane-6-carboxamide is sourced from PubChem (CID 73115355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).