About methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate
methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 73115471) has the molecular formula C12H12FNO2
and a molecular weight of 221.23 g/mol. Its IUPAC name is methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate |
| PubChem CID | 73115471 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | COC(=O)C1CCC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C12H12FNO2/c1-16-12(15)11-7-6-10(14-11)8-2-4-9(13)5-3-8/h2-5,11H,6-7H2,1H3 |
| InChIKey | OCNYVMWUOOLUOA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate?
The IUPAC name of methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate (CID 73115471) is methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate?
The canonical SMILES for methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate is COC(=O)C1CCC(c2ccc(F)cc2)=N1.
What is the InChIKey of methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate?
The InChIKey is OCNYVMWUOOLUOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2/c1-16-12(15)11-7-6-10(14-11)8-2-4-9(13)5-3-8/h2-5,11H,6-7H2,1H3.
What are the key properties of methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate?
methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate has a molecular weight of 221.23 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole-2-carboxylate is sourced from PubChem (CID 73115471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).