C14H16O4 — CID 73115642
4-hex-4-enoyl-5-hydroxy-3,6-dimethylcyclohexa-3,5-diene-1,2-dione (PubChem CID 73115642) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-hex-4-enoyl-5-hydroxy-3,6-dimethylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-hex-4-enoyl-5-hydroxy-3,6-dimethylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 73115642 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-hex-4-enoyl-5-hydroxy-3,6-dimethylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC=CCCC(=O)C1=C(C)C(=O)C(=O)C(C)=C1O |
| InChI | InChI=1S/C14H16O4/c1-4-5-6-7-10(15)11-8(2)13(17)14(18)9(3)12(11)16/h4-5,16H,6-7H2,1-3H3 |
| InChIKey | AXEZOCXIWCSNHL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|