About CID 73116340
CID 73116340 (PubChem CID 73116340) has the molecular formula C4H7LiO2S2
and a molecular weight of 158.17 g/mol.
Molecular Properties
| Compound Name | CID 73116340 |
| PubChem CID | 73116340 |
| Molecular Formula | C4H7LiO2S2 |
| Molecular Weight | 158.17 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | — |
| SMILES | O=S1[CH-]S(=O)CCC1.[Li+] |
| InChI | InChI=1S/C4H7O2S2.Li/c5-7-2-1-3-8(6)4-7;/h4H,1-3H2;/q-1;+1 |
| InChIKey | JCCKLGLKZPSRPQ-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.17 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 73116340 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73116340?
The IUPAC name of CID 73116340 (CID 73116340) is not available.
What is the SMILES notation for CID 73116340?
The canonical SMILES for CID 73116340 is O=S1[CH-]S(=O)CCC1.[Li+].
What is the InChIKey of CID 73116340?
The InChIKey is JCCKLGLKZPSRPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O2S2.Li/c5-7-2-1-3-8(6)4-7;/h4H,1-3H2;/q-1;+1.
What are the key properties of CID 73116340?
CID 73116340 has a molecular weight of 158.17 g/mol, XLogP of -2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73116340 is sourced from PubChem (CID 73116340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).