C15H22O8S2 — CID 73118580
(3,4-diacetyloxy-6-ethoxycarbothioylsulfanyloxan-2-yl)methyl acetate (PubChem CID 73118580) has the molecular formula C15H22O8S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (3,4-diacetyloxy-6-ethoxycarbothioylsulfanyloxan-2-yl)methyl acetate.
| Compound Name | (3,4-diacetyloxy-6-ethoxycarbothioylsulfanyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 73118580 |
| Molecular Formula | C15H22O8S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (3,4-diacetyloxy-6-ethoxycarbothioylsulfanyloxan-2-yl)methyl acetate |
| SMILES | CCOC(=S)SC1CC(OC(C)=O)C(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C15H22O8S2/c1-5-19-15(24)25-13-6-11(21-9(3)17)14(22-10(4)18)12(23-13)7-20-8(2)16/h11-14H,5-7H2,1-4H3 |
| InChIKey | BZZXKCLQADLILM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|