About 9-oxonona-5,7-dienyl acetate
9-oxonona-5,7-dienyl acetate (PubChem CID 73120862) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 9-oxonona-5,7-dienyl acetate.
Molecular Properties
| Compound Name | 9-oxonona-5,7-dienyl acetate |
| PubChem CID | 73120862 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 9-oxonona-5,7-dienyl acetate |
| SMILES | CC(=O)OCCCCC=CC=CC=O |
| InChI | InChI=1S/C11H16O3/c1-11(13)14-10-8-6-4-2-3-5-7-9-12/h2-3,5,7,9H,4,6,8,10H2,1H3 |
| InChIKey | XWNWNRAILIVPFN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9-oxonona-5,7-dienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxonona-5,7-dienyl acetate?
The IUPAC name of 9-oxonona-5,7-dienyl acetate (CID 73120862) is 9-oxonona-5,7-dienyl acetate.
What is the SMILES notation for 9-oxonona-5,7-dienyl acetate?
The canonical SMILES for 9-oxonona-5,7-dienyl acetate is CC(=O)OCCCCC=CC=CC=O.
What is the InChIKey of 9-oxonona-5,7-dienyl acetate?
The InChIKey is XWNWNRAILIVPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-11(13)14-10-8-6-4-2-3-5-7-9-12/h2-3,5,7,9H,4,6,8,10H2,1H3.
What are the key properties of 9-oxonona-5,7-dienyl acetate?
9-oxonona-5,7-dienyl acetate has a molecular weight of 196.25 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxonona-5,7-dienyl acetate is sourced from PubChem (CID 73120862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).