About 2-heptyl-3-penta-2,4-diynyloxirane
2-heptyl-3-penta-2,4-diynyloxirane (PubChem CID 73120919) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-heptyl-3-penta-2,4-diynyloxirane.
Molecular Properties
| Compound Name | 2-heptyl-3-penta-2,4-diynyloxirane |
| PubChem CID | 73120919 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-heptyl-3-penta-2,4-diynyloxirane |
| SMILES | C#CC#CCC1OC1CCCCCCC |
| InChI | InChI=1S/C14H20O/c1-3-5-7-8-10-12-14-13(15-14)11-9-6-4-2/h2,13-14H,3,5,7-8,10-12H2,1H3 |
| InChIKey | CRSUKNCTBDUAQP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-3-penta-2,4-diynyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-3-penta-2,4-diynyloxirane?
The IUPAC name of 2-heptyl-3-penta-2,4-diynyloxirane (CID 73120919) is 2-heptyl-3-penta-2,4-diynyloxirane.
What is the SMILES notation for 2-heptyl-3-penta-2,4-diynyloxirane?
The canonical SMILES for 2-heptyl-3-penta-2,4-diynyloxirane is C#CC#CCC1OC1CCCCCCC.
What is the InChIKey of 2-heptyl-3-penta-2,4-diynyloxirane?
The InChIKey is CRSUKNCTBDUAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-3-5-7-8-10-12-14-13(15-14)11-9-6-4-2/h2,13-14H,3,5,7-8,10-12H2,1H3.
What are the key properties of 2-heptyl-3-penta-2,4-diynyloxirane?
2-heptyl-3-penta-2,4-diynyloxirane has a molecular weight of 204.31 g/mol, XLogP of 3.14, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-3-penta-2,4-diynyloxirane is sourced from PubChem (CID 73120919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).