About N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide
N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide (PubChem CID 73122067) has the molecular formula C17H28F3NO
and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide |
| PubChem CID | 73122067 |
| Molecular Formula | C17H28F3NO |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide |
| SMILES | CCCCCCC=CC(NC(=O)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C17H28F3NO/c1-2-3-4-5-6-10-13-15(14-11-8-7-9-12-14)21-16(22)17(18,19)20/h10,13-15H,2-9,11-12H2,1H3,(H,21,22) |
| InChIKey | SSGXICUYACVZAB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide (CID 73122067) is N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide is CCCCCCC=CC(NC(=O)C(F)(F)F)C1CCCCC1.
What is the InChIKey of N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide?
The InChIKey is SSGXICUYACVZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28F3NO/c1-2-3-4-5-6-10-13-15(14-11-8-7-9-12-14)21-16(22)17(18,19)20/h10,13-15H,2-9,11-12H2,1H3,(H,21,22).
What are the key properties of N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide?
N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide has a molecular weight of 319.41 g/mol, XLogP of 5.14, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclohexylnon-2-enyl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 73122067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).