C17H19N5S — CID 7312903
N-benzyl-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanethioamide (PubChem CID 7312903) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is N-benzyl-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanethioamide.
| Compound Name | N-benzyl-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 7312903 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-benzyl-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanethioamide |
| SMILES | N#CC(C(=S)NCc1ccccc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H19N5S/c18-11-14(17(23)19-12-13-7-3-1-4-8-13)16-21-20-15-9-5-2-6-10-22(15)16/h1,3-4,7-8,14H,2,5-6,9-10,12H2,(H,19,23) |
| InChIKey | BBCRGXDHVKDYJB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|