C18H22N6 — CID 73129410
6-imino-1',2-dimethylspiro[1,3,5,8a-tetrahydroisoquinoline-8,4'-piperidine]-5,7,7-tricarbonitrile (PubChem CID 73129410) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 6-imino-1',2-dimethylspiro[1,3,5,8a-tetrahydroisoquinoline-8,4'-piperidine]-5,7,7-tricarbonitrile.
| Compound Name | 6-imino-1',2-dimethylspiro[1,3,5,8a-tetrahydroisoquinoline-8,4'-piperidine]-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 73129410 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 6-imino-1',2-dimethylspiro[1,3,5,8a-tetrahydroisoquinoline-8,4'-piperidine]-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(C)CC2C2(CCN(C)CC2)C1(C#N)C#N |
| InChI | InChI=1S/C18H22N6/c1-23-7-4-17(5-8-23)15-10-24(2)6-3-13(15)14(9-19)16(22)18(17,11-20)12-21/h3,14-15,22H,4-8,10H2,1-2H3/b22-16+ |
| InChIKey | DFCULCJCOCSVED-CJLVFECKSA-N |
| XLogP | 1.39 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|