C16H22N7S2+ — CID 7312989
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-methylpiperazin-4-ium-1-carbodithioate (PubChem CID 7312989) has the molecular formula C16H22N7S2+ and a molecular weight of 376.54 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-methylpiperazin-4-ium-1-carbodithioate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-methylpiperazin-4-ium-1-carbodithioate |
|---|---|
| PubChem CID | 7312989 |
| Molecular Formula | C16H22N7S2+ |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-methylpiperazin-4-ium-1-carbodithioate |
| SMILES | C[NH+]1CCN(C(=S)SCc2nc(N)nc(Nc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C16H21N7S2/c1-22-7-9-23(10-8-22)16(24)25-11-13-19-14(17)21-15(20-13)18-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H3,17,18,19,20,21)/p+1 |
| InChIKey | VQZUBKWLCSEACV-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|