C26H26N2OS — CID 7313086
N-[(4R)-2,2,4-trimethyl-4-phenyl-3H-quinoline-1-carbothioyl]benzamide (PubChem CID 7313086) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[(4R)-2,2,4-trimethyl-4-phenyl-3H-quinoline-1-carbothioyl]benzamide.
| Compound Name | N-[(4R)-2,2,4-trimethyl-4-phenyl-3H-quinoline-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 7313086 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(4R)-2,2,4-trimethyl-4-phenyl-3H-quinoline-1-carbothioyl]benzamide |
| SMILES | CC1(C)C[C@](C)(c2ccccc2)c2ccccc2N1C(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2OS/c1-25(2)18-26(3,20-14-8-5-9-15-20)21-16-10-11-17-22(21)28(25)24(30)27-23(29)19-12-6-4-7-13-19/h4-17H,18H2,1-3H3,(H,27,29,30)/t26-/m1/s1 |
| InChIKey | OYWYRGAQOYUSAP-AREMUKBSSA-N |
| XLogP | 5.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|