C15H23N6O3S+ — CID 7313230
N-prop-2-enyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide (PubChem CID 7313230) has the molecular formula C15H23N6O3S+ and a molecular weight of 367.46 g/mol. Its IUPAC name is N-prop-2-enyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-prop-2-enyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7313230 |
| Molecular Formula | C15H23N6O3S+ |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-prop-2-enyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CC[NH+](CC/N=C/C2C(=O)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C15H22N6O3S/c1-2-3-17-15(25)21-8-6-20(7-9-21)5-4-16-10-11-12(22)18-14(24)19-13(11)23/h2,10-11H,1,3-9H2,(H,17,25)(H2,18,19,22,23,24)/p+1/b16-10+ |
| InChIKey | JONBGUCBEQHTLB-MHWRWJLKSA-O |
| XLogP | -2.70 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|