C14H24N2O5 — CID 73132932
N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide (PubChem CID 73132932) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide.
| Compound Name | N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 73132932 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NC1COC2C(OCC(N)=O)COC12 |
| InChI | InChI=1S/C14H24N2O5/c1-3-8(4-2)14(18)16-9-5-20-13-10(6-21-12(9)13)19-7-11(15)17/h8-10,12-13H,3-7H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | DSKJFOSPRWFOJI-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |