C9H17NO5S — CID 73133421
N-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)propane-1-sulfonamide (PubChem CID 73133421) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is N-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)propane-1-sulfonamide.
| Compound Name | N-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 73133421 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC1COC2C(O)COC12 |
| InChI | InChI=1S/C9H17NO5S/c1-2-3-16(12,13)10-6-4-14-9-7(11)5-15-8(6)9/h6-11H,2-5H2,1H3 |
| InChIKey | FSGVCQGHOCOMBK-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |