About 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione
5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione (PubChem CID 731344) has the molecular formula C5H11N3OS
and a molecular weight of 161.23 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione |
| PubChem CID | 731344 |
| Molecular Formula | C5H11N3OS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione |
| SMILES | OCCN1CNC(=S)NC1 |
| InChI | InChI=1S/C5H11N3OS/c9-2-1-8-3-6-5(10)7-4-8/h9H,1-4H2,(H2,6,7,10) |
| InChIKey | NATVVRFRJHJKDJ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione?
The IUPAC name of 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione (CID 731344) is 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione.
What is the SMILES notation for 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione?
The canonical SMILES for 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione is OCCN1CNC(=S)NC1.
What is the InChIKey of 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione?
The InChIKey is NATVVRFRJHJKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3OS/c9-2-1-8-3-6-5(10)7-4-8/h9H,1-4H2,(H2,6,7,10).
What are the key properties of 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione?
5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione has a molecular weight of 161.23 g/mol, XLogP of -1.33, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione is sourced from PubChem (CID 731344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).