C11H15N4O4P — CID 73135773
N-[furan-2-yl-(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]-1,2,4-triazol-4-amine (PubChem CID 73135773) has the molecular formula C11H15N4O4P and a molecular weight of 298.24 g/mol. Its IUPAC name is N-[furan-2-yl-(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]-1,2,4-triazol-4-amine.
| Compound Name | N-[furan-2-yl-(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 73135773 |
| Molecular Formula | C11H15N4O4P |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-[furan-2-yl-(4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]-1,2,4-triazol-4-amine |
| SMILES | CC1CCOP(=O)(C(Nn2cnnc2)c2ccco2)O1 |
| InChI | InChI=1S/C11H15N4O4P/c1-9-4-6-18-20(16,19-9)11(10-3-2-5-17-10)14-15-7-12-13-8-15/h2-3,5,7-9,11,14H,4,6H2,1H3 |
| InChIKey | LYIFXZYQQBSXFN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|