C24H28N4S — CID 7313666
6-(3,5-ditert-butylphenyl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 7313666) has the molecular formula C24H28N4S and a molecular weight of 404.58 g/mol. Its IUPAC name is 6-(3,5-ditert-butylphenyl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(3,5-ditert-butylphenyl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 7313666 |
| Molecular Formula | C24H28N4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 6-(3,5-ditert-butylphenyl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1ccc(-c2nnc3sc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)nn23)cc1 |
| InChI | InChI=1S/C24H28N4S/c1-15-8-10-16(11-9-15)20-25-26-22-28(20)27-21(29-22)17-12-18(23(2,3)4)14-19(13-17)24(5,6)7/h8-14H,1-7H3 |
| InChIKey | QLHXJKKRCJVYBE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |