About 2-phenylethanethioamide
2-phenylethanethioamide (PubChem CID 731368) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is 2-phenylethanethioamide.
Molecular Properties
| Compound Name | 2-phenylethanethioamide |
| PubChem CID | 731368 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 2-phenylethanethioamide |
| SMILES | NC(=S)Cc1ccccc1 |
| InChI | InChI=1S/C8H9NS/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | CJXBHFANXQMZBF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethanethioamide?
The IUPAC name of 2-phenylethanethioamide (CID 731368) is 2-phenylethanethioamide.
What is the SMILES notation for 2-phenylethanethioamide?
The canonical SMILES for 2-phenylethanethioamide is NC(=S)Cc1ccccc1.
What is the InChIKey of 2-phenylethanethioamide?
The InChIKey is CJXBHFANXQMZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10).
What are the key properties of 2-phenylethanethioamide?
2-phenylethanethioamide has a molecular weight of 151.23 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethanethioamide is sourced from PubChem (CID 731368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).