About 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate
7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 73140456) has the molecular formula C12H14O4-2
and a molecular weight of 222.24 g/mol. Its IUPAC name is 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 73140456 |
| Molecular Formula | C12H14O4-2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CC(C)=C1C2CCC1C(C(=O)[O-])C2C(=O)[O-] |
| InChI | InChI=1S/C12H16O4/c1-5(2)8-6-3-4-7(8)10(12(15)16)9(6)11(13)14/h6-7,9-10H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | POESARFBVDOHKT-UHFFFAOYSA-L |
| XLogP | -0.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 73140456) is 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate is CC(C)=C1C2CCC1C(C(=O)[O-])C2C(=O)[O-].
What is the InChIKey of 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is POESARFBVDOHKT-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H16O4/c1-5(2)8-6-3-4-7(8)10(12(15)16)9(6)11(13)14/h6-7,9-10H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-2.
What are the key properties of 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate?
7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 222.24 g/mol, XLogP of -0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 73140456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).