About (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial
(2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial (PubChem CID 7314345) has the molecular formula C22H16N2S2
and a molecular weight of 372.52 g/mol. Its IUPAC name is (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial.
Molecular Properties
| Compound Name | (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial |
| PubChem CID | 7314345 |
| Molecular Formula | C22H16N2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial |
| SMILES | S=C/C(=C1/SC(c2ccccc2)=NN1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16N2S2/c25-16-20(17-10-4-1-5-11-17)22-24(19-14-8-3-9-15-19)23-21(26-22)18-12-6-2-7-13-18/h1-16H/b22-20- |
| InChIKey | BILOQJOOPQIZLU-XDOYNYLZSA-N |
| XLogP | 5.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial?
The IUPAC name of (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial (CID 7314345) is (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial.
What is the SMILES notation for (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial?
The canonical SMILES for (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial is S=C/C(=C1/SC(c2ccccc2)=NN1c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial?
The InChIKey is BILOQJOOPQIZLU-XDOYNYLZSA-N. The full InChI is InChI=1S/C22H16N2S2/c25-16-20(17-10-4-1-5-11-17)22-24(19-14-8-3-9-15-19)23-21(26-22)18-12-6-2-7-13-18/h1-16H/b22-20-.
What are the key properties of (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial?
(2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial has a molecular weight of 372.52 g/mol, XLogP of 5.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-2-phenylethanethial is sourced from PubChem (CID 7314345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).