C22H25NO — CID 7314597
(4S)-4-propan-2-yl-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 7314597) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is (4S)-4-propan-2-yl-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-propan-2-yl-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 7314597 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (4S)-4-propan-2-yl-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@H]1COC(c2cc3ccc2CCc2ccc(cc2)CC3)=N1 |
| InChI | InChI=1S/C22H25NO/c1-15(2)21-14-24-22(23-21)20-13-18-8-7-16-3-5-17(6-4-16)9-11-19(20)12-10-18/h3-6,10,12-13,15,21H,7-9,11,14H2,1-2H3/t21-/m1/s1 |
| InChIKey | GNRSEZXNVULHOY-OAQYLSRUSA-N |
| XLogP | 4.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |