C20H20BrNO3 — CID 7314643
4-bromo-2-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-7-(ethylamino)cyclohepta-2,4,6-trien-1-one (PubChem CID 7314643) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is 4-bromo-2-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-7-(ethylamino)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 4-bromo-2-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-7-(ethylamino)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 7314643 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 4-bromo-2-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-7-(ethylamino)cyclohepta-2,4,6-trien-1-one |
| SMILES | CCNc1ccc(Br)cc(C(=O)/C=C/c2ccc(OCC)cc2)c1=O |
| InChI | InChI=1S/C20H20BrNO3/c1-3-22-18-11-8-15(21)13-17(20(18)24)19(23)12-7-14-5-9-16(10-6-14)25-4-2/h5-13H,3-4H2,1-2H3,(H,22,24)/b12-7+ |
| InChIKey | LIEDIAOTRZYZAI-KPKJPENVSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|